CAS 59528-27-7
:4-Iodobenzylamine hydrochloride
Description:
4-Iodobenzylamine hydrochloride is an organic compound characterized by its structure, which includes a benzene ring substituted with an iodine atom and an amino group. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it useful in various chemical applications. The presence of the amino group contributes to its basicity, allowing it to form salts, such as the hydrochloride form, which enhances its solubility and stability. 4-Iodobenzylamine hydrochloride is often utilized in pharmaceutical research and synthesis, particularly in the development of biologically active compounds. Its iodine substituent can facilitate further chemical modifications, making it a valuable intermediate in organic synthesis. Additionally, the compound may exhibit biological activity, which is of interest in medicinal chemistry. As with many chemical substances, proper handling and safety precautions are essential due to potential hazards associated with its use.
Formula:C7H9ClIN
InChI:InChI=1/C7H8IN.ClH/c8-7-3-1-6(5-9)2-4-7;/h1-4H,5,9H2;1H
SMILES:c1cc(ccc1CN)I.Cl
Synonyms:- 1-(4-Iodophenyl)Methanamine Hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Iodobenzylamine hydrochloride, 97%
CAS:4-Iodobenzylamine hydrochloride is used to prepare cyclic amide by reacting with methyl 4-bromomethyl-3-methoxycarbonylcinnamate in the presence of triethylamine. It is also used in pharmaceuticals, agrochemicals and dye industries. This Thermo Scientific Chemicals brand product was originally part
Formula:C7H9ClINPurity:97%Color and Shape:White to cream, Crystals or powder or crystalline powderMolecular weight:269.514-Iodobenzylamine hydrochloride
CAS:4-Iodobenzylamine hydrochlorideFormula:C7H8IN·ClHPurity:≥95%Color and Shape: white to off white solidMolecular weight:269.51g/mol(4-Iodophenyl)methanamine hydrochloride
CAS:Formula:C7H9ClINPurity:95%Color and Shape:SolidMolecular weight:269.51



