CAS 59541-58-1

5-(Thien-2-yl)-1H-tetrazole

Description:

5-(Thien-2-yl)-1H-tetrazole is a heterocyclic compound characterized by the presence of a tetrazole ring, which consists of four nitrogen atoms and one carbon atom, fused with a thiophene moiety (thienyl group). This compound exhibits notable properties such as high thermal stability and potential for forming hydrogen bonds due to the nitrogen atoms in the tetrazole ring. It is often utilized in medicinal chemistry and material science due to its ability to act as a bioisostere for carboxylic acids, enhancing the pharmacological profile of various compounds. The presence of the thiophene ring contributes to its electronic properties, making it a candidate for applications in organic electronics and as a building block in the synthesis of more complex molecules. Additionally, 5-(Thien-2-yl)-1H-tetrazole may exhibit interesting biological activities, including antimicrobial and anti-inflammatory effects, although specific biological data may vary. Its solubility and reactivity can be influenced by the substituents on the thiophene ring, making it a versatile compound in synthetic chemistry.

Formula: C₅H₄N₄S

InChI: InChI=1/C5H4N4S/c1-2-4(10-3-1)5-6-8-9-7-5/h1-3H,(H,6,7,8,9)

SMILES: c1cc(c2n[nH]nn2)sc1

Synonyms:

• 5-(thiophen-2-yl)-2H-tetrazole

2-(2H-Tetrazol-5-yl)thiophene

CAS: 59541-58-1

2-(2H-Tetrazol-5-yl)thiophene

Purity: ≥95%

Molecular weight: 152.18g/mol

Ref: 54-OR103677

5-Thiophen-2-yl-2H-tetrazole

CAS: 59541-58-1

Formula: C₅H₄N₄S

Color and Shape: Solid, Yellow crystalline powder

Molecular weight: 152.18

Ref: 10-F025801

5-(Thiophen-2-yl)-2H-1,2,3,4-tetrazole

CAS: 59541-58-1

5-(Thiophen-2-yl)-2H-1,2,3,4-tetrazole is an antibiotic that belongs to the group of tetrazoles. It has been shown to have bactericidal and bacteriostatic properties against Streptococcus and Staphylococcus strains. 5-(Thiophen-2-yl)-2H-1,2,3,4-tetrazole inhibits bacterial growth by inhibiting the enzyme dehydrogenase that catalyzes the conversion of branched chain amino acids into energy. 5-(Thiophen-2-yl)-2H-1,2,3,4-tetrazole also has a strong disinfectant effect on bacteria because it reacts with acid in the environment to form a highly reactive species that damages DNA.

Formula: C₅H₄N₄S

Purity: Min. 95%

Molecular weight: 152.18 g/mol

Ref: 3D-JCA54158