CAS 59553-09-2
:6,10b-dihydropyrazolo[1,5-c]quinazoline-5(1H)-thione
Description:
6,10b-Dihydropyrazolo[1,5-c]quinazoline-5(1H)-thione is a heterocyclic compound characterized by its unique pyrazoloquinazoline structure, which incorporates both pyrazole and quinazoline moieties. This compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which contributes to its reactivity and potential biological activity. The molecular structure typically exhibits a fused ring system, which can influence its physical properties, such as solubility and stability. Compounds of this nature are often investigated for their pharmacological properties, including potential anti-inflammatory, antimicrobial, or anticancer activities. The presence of nitrogen and sulfur in the structure may also enhance its interaction with biological targets. As with many heterocycles, the electronic properties and steric factors play a crucial role in determining the compound's behavior in chemical reactions and its interactions in biological systems. Overall, 6,10b-dihydropyrazolo[1,5-c]quinazoline-5(1H)-thione represents a class of compounds with significant potential for further research in medicinal chemistry.
Formula:C10H9N3S
InChI:InChI=1/C10H9N3S/c14-10-12-8-4-2-1-3-7(8)9-5-6-11-13(9)10/h1-4,6,9H,5H2,(H,12,14)
SMILES:c1ccc2c(c1)C1CC=NN1C(=N2)S
Synonyms:- 1,10B-Dihydropyrazolo[1,5-C]Quinazoline-5-Thiol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1H,5H,6H,10Bh-Pyrazolo[1,5-c]quinazoline-5-thione
CAS:1H,5H,6H,10Bh-Pyrazolo[1,5-c]quinazoline-5-thione is a heterocyclic compound composed of a benzene ring fused to a thiazole. It has been shown to react with thiophosgene in the presence of sodium borohydride and hydrazine to form the corresponding alkylated product. The reaction proceeds via an analogous mechanism. 1H,5H,6H,10Bh-Pyrazolo[1,5-c]quinazoline-5-thione also reacts with quinoline in the presence of acylation agents such as sulfonyl chlorides or acyl chlorides to form the corresponding ester. This compound can be used in alkali fission reactions that are analogous to hydrogen/deuterium exchange reactions.Formula:C10H9N3SPurity:Min. 95%Molecular weight:203.27 g/mol
