CAS 59554-12-0
:[4'-(acetyloxy)-3',9-dihydroxy-6'-methyl-5,10-dioxo-3,3',4,4',5,5',6',10-octahydrospiro[benzo[g]isochromene-1,2'-pyran]-3-yl]acetic acid
Description:
The chemical substance with the name "[4'-(acetyloxy)-3',9-dihydroxy-6'-methyl-5,10-dioxo-3,3',4,4',5,5',6',10-octahydrospiro[benzo[g]isochromene-1,2'-pyran]-3-yl]acetic acid" and CAS number "59554-12-0" is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as hydroxyl (-OH), acetoxy (-OCOCH3), and carboxylic acid (-COOH) groups. This compound features a spirocyclic framework, indicating a unique arrangement of rings that contributes to its potential biological activity. The presence of multiple hydroxyl groups suggests that it may exhibit significant solubility in polar solvents and could participate in hydrogen bonding, influencing its reactivity and interactions with biological systems. Additionally, the dioxo groups indicate potential for redox activity. Such compounds are often of interest in medicinal chemistry for their possible therapeutic properties, including anti-inflammatory or antioxidant effects. However, specific biological activities and applications would require further investigation through experimental studies.
Formula:C22H22O10
InChI:InChI=1/C22H22O10/c1-9-6-15(30-10(2)23)21(29)22(31-9)18-13(7-11(32-22)8-16(25)26)19(27)12-4-3-5-14(24)17(12)20(18)28/h3-5,9,11,15,21,24,29H,6-8H2,1-2H3,(H,25,26)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Griseusin B
CAS:<p>Griseusin B is a quinone antibiotic primarily effective against Gram-positive bacteria.</p>Formula:C22H22O10Color and Shape:SolidMolecular weight:446.404
