CAS 59557-93-6
:1-Bromo-4-(dimethylamino)naphthalene
Description:
1-Bromo-4-(dimethylamino)naphthalene is an organic compound characterized by its naphthalene backbone substituted with a bromine atom and a dimethylamino group. This compound typically appears as a solid at room temperature and is known for its aromatic properties due to the presence of the naphthalene structure. The bromine atom introduces a halogen functionality, which can enhance the compound's reactivity in various chemical reactions, such as nucleophilic substitutions. The dimethylamino group contributes to the compound's basicity and can influence its electronic properties, making it useful in various applications, including as a dye intermediate or in organic synthesis. Additionally, the presence of both the bromine and dimethylamino groups can affect the compound's solubility in different solvents, often making it more soluble in polar organic solvents. Safety precautions should be taken when handling this compound, as it may pose health risks, including potential toxicity and environmental hazards.
Formula:C12H12BrN
InChI:InChI=1/C12H12BrN/c1-14(2)12-8-7-11(13)9-5-3-4-6-10(9)12/h3-8H,1-2H3
SMILES:CN(C)c1ccc(c2ccccc12)Br
Synonyms:- 4-Bromo-N,N-dimethyl-1-naphthylamine
- 4-bromo-N,N-dimethylnaphthalen-1-amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-Bromo-4-(dimethylamino)naphthalene, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C12H12BrNPurity:95%Color and Shape:Liquid, Clear yellow to orangeMolecular weight:250.144-Bromo-N,N-dimethylnaphthalen-1-amine
CAS:Formula:C12H12BrNPurity:95%Color and Shape:LiquidMolecular weight:250.1344


