CAS 59559-06-7
:1,1'-[ethane-1,2-diylbis(oxy)]bis(2-azidoethane)
Description:
1,1'-[Ethane-1,2-diylbis(oxy)]bis(2-azidoethane), with the CAS number 59559-06-7, is a chemical compound characterized by its unique structure featuring two azido groups attached to an ethylene glycol backbone. This compound is notable for its potential applications in organic synthesis and materials science, particularly in the development of energetic materials due to the presence of azide functional groups, which are known for their reactivity and ability to release nitrogen gas upon decomposition. The presence of ether linkages contributes to its solubility in organic solvents, while the azido groups can participate in various chemical reactions, including click chemistry. Safety considerations are paramount when handling this compound, as azides can be sensitive to heat, shock, and friction, posing risks of detonation. Overall, 1,1'-[ethane-1,2-diylbis(oxy)]bis(2-azidoethane) exemplifies a class of compounds that bridge the fields of synthetic chemistry and materials engineering, with ongoing research into its properties and potential applications.
Formula:C6H12N6O2
InChI:InChI=1/C6H12N6O2/c7-11-9-1-3-13-5-6-14-4-2-10-12-8/h1-6H2
SMILES:C(COCCOCCN=[N+]=[NH-])N=[N+]=[NH-]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
1,8-Diazido-3,5-dioxaoctane
CAS:Formula:C6H12N6O2Purity:98%Color and Shape:LiquidMolecular weight:200.1985Azido-PEG2-azide
CAS:Azido-PEG2-azide is a PEG-based PROTAC linker that can be used in PROTAC synthesis.Formula:C6H12N6O2Purity:>99.99%Color and Shape:SolidMolecular weight:200.21,8-Diazido-3,6-dioxaoctane
CAS:Controlled ProductFormula:C6H12N6O2Color and Shape:NeatMolecular weight:200.201,8-Diazido-3,6-dioxaoctane
CAS:1,8-Diazido-3,6-dioxaoctane is a synthetic molecule that is used in the synthesis of macrolactones, polymers, and biomolecules. It can be used as a bioconjugate to attach other functional groups to biomaterials and polymers, such as azido groups. This compound has high sensitivity and thermal stability with good solubility in organic solvents. 1,8-Diazido-3,6-dioxaoctane has been shown to be compatible with many functional groups and is an important monomer for use in cross-linked polymers.Formula:C6H12N6O2Purity:Min. 95%Color and Shape:Colorless PowderMolecular weight:200.2 g/mol





