CAS 59565-53-6

4-(5-Amino-1,3,4-thiadiazol-2-yl)phenol

Description:

4-(5-Amino-1,3,4-thiadiazol-2-yl)phenol, with the CAS number 59565-53-6, is an organic compound characterized by the presence of both a phenolic group and a thiadiazole moiety. This compound features a phenol ring substituted with a thiadiazole that contains an amino group, which contributes to its potential biological activity. The presence of the amino group can enhance its solubility in polar solvents and may facilitate interactions with biological targets, making it of interest in medicinal chemistry. The thiadiazole ring is known for its diverse pharmacological properties, including antimicrobial and antifungal activities. Additionally, the compound may exhibit antioxidant properties due to the phenolic structure. Its synthesis typically involves the reaction of appropriate precursors under controlled conditions. As with many organic compounds, its stability, reactivity, and potential applications can be influenced by factors such as pH, temperature, and the presence of other chemical species. Overall, 4-(5-Amino-1,3,4-thiadiazol-2-yl)phenol represents a versatile structure with potential applications in pharmaceuticals and agrochemicals.

Formula: C₈H₇N₃OS

InChI: InChI=1S/C8H7N3OS/c9-8-11-10-7(13-8)5-1-3-6(12)4-2-5/h1-4,12H,(H2,9,11)

InChI key: InChIKey=ZLHDTOUWXDZDGO-UHFFFAOYSA-N

SMILES: NC=1SC(C2=CC=C(O)C=C2)=NN1

Synonyms:

• Phenol, 4-(5-amino-1,3,4-thiadiazol-2-yl)-
• TDZ-K
• 4-(5-Amino-1,3,4-thiadiazol-2-yl)phenol
• 5-(4-Hydroxyphenyl)-1,3,4-thiadiazol-2-amine
• ASINEX-REAG BAS 06910925

5-(4-Hydroxyphenyl)-1,3,4-thiadiazole-2-amine

CAS: 59565-53-6

Formula: C₈H₇N₃OS

Purity: 95.0%

Molecular weight: 193.22

Ref: 10-F304453

4-(5-Amino-[1,3,4]thiadiazol-2-yl)-phenol

CAS: 59565-53-6

4-(5-Amino-[1,3,4]thiadiazol-2-yl)-phenol is a fluorescent probe that has been shown to be active against the transcription-polymerase chain of various plant viruses. It is also capable of inhibiting the replication of human immunodeficiency virus type 1 (HIV-1) and murine leukemia virus (MLV). 4-(5-Amino-[1,3,4]thiadiazol-2-yl)-phenol has been used to detect signal in living cells and tissues by fluorescence microscopy. This probe can also be used to detect protein ubiquitination and proteasomal degradation in a variety of organisms, including humans and mice.

Formula: C₈H₇N₃OS

Purity: Min. 95%

Molecular weight: 193.23 g/mol

Ref: 3D-JCA56553