CAS 5957-97-1

3-(4-chlorophenyl)pyridine

Description:

3-(4-Chlorophenyl)pyridine, with the CAS number 5957-97-1, is an organic compound characterized by its pyridine ring substituted with a 4-chlorophenyl group at the 3-position. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its aromatic properties due to the presence of both the pyridine and phenyl rings. It exhibits moderate polarity, which influences its solubility in various organic solvents. The chlorophenyl group contributes to its potential reactivity and biological activity, making it of interest in pharmaceutical and agrochemical research. The compound may participate in electrophilic substitution reactions due to the electron-withdrawing nature of the chlorine atom, which can affect the reactivity of the aromatic system. Additionally, 3-(4-chlorophenyl)pyridine may exhibit specific interactions with biological targets, making it relevant in the study of medicinal chemistry. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.

Formula: C₁₁H₈ClN

InChI: InChI=1/C11H8ClN/c12-11-5-3-9(4-6-11)10-2-1-7-13-8-10/h1-8H

SMILES: c1cc(cnc1)c1ccc(cc1)Cl

Synonyms:

• Pyridine, 3-(4-chlorophenyl)-

3-(4-Chloro-phenyl)-pyridine

CAS: 5957-97-1

Formula: C₁₁H₈ClN

Purity: 95%

Color and Shape: Liquid

Molecular weight: 189.6409

Ref: IN-DA00EGPI

3-(4-Chloro-phenyl)-pyridine

CAS: 5957-97-1

Formula: C₁₁H₈ClN

Purity: 95%

Molecular weight: 189.64

Ref: 10-F034578