CAS 59576-33-9

2-(2-Pyridinyl)-1-(3-pyridinyl)ethanone

Description:

2-(2-Pyridinyl)-1-(3-pyridinyl)ethanone, with the CAS number 59576-33-9, is an organic compound characterized by its dual pyridine rings attached to an ethanone moiety. This compound features a ketone functional group, which contributes to its reactivity and potential applications in various chemical reactions. The presence of the pyridine rings, which are aromatic heterocycles, imparts unique electronic properties, making it a candidate for use in pharmaceuticals and agrochemicals. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents due to the presence of the ketone group. Its molecular structure allows for potential interactions with biological targets, which is of interest in medicinal chemistry. Additionally, the compound may participate in hydrogen bonding and other intermolecular interactions, influencing its behavior in different environments. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₂H₁₀N₂O

InChI: InChI=1S/C12H10N2O/c15-12(10-4-3-6-13-9-10)8-11-5-1-2-7-14-11/h1-7,9H,8H2

InChI key: InChIKey=VXRWCMGYLGCAOZ-UHFFFAOYSA-N

SMILES: C(CC1=CC=CC=N1)(=O)C=2C=CC=NC2

Synonyms:

• Ethanone, 2-(2-pyridinyl)-1-(3-pyridinyl)-
• NSC 278059
• 2-(Pyridin-2-yl)-1-(pyridin-3-yl)ethan-1-one
• 2-(2-Pyridinyl)-1-(3-pyridinyl)ethanone
• Ketone, 3-pyridyl 2-pyridylmethyl

2-(Pyridin-2-yl)-1-(pyridin-3-yl)ethan-1-one

CAS: 59576-33-9

Versatile small molecule scaffold

Formula: C₁₂H₁₀N₂O

Purity: Min. 95%

Molecular weight: 198.22 g/mol

Ref: 3D-JCA57633