CAS 59587-07-4
:2-azidoadenosine
Description:
2-Azidoadenosine is a modified nucleoside that features an azido group (-N3) at the 2-position of the adenine base. This compound is characterized by its structural similarity to adenosine, which is a key component of nucleic acids and plays a crucial role in cellular energy transfer and signaling. The presence of the azido group imparts unique chemical properties, making 2-azidoadenosine a valuable tool in biochemical research, particularly in studies involving nucleic acid interactions and modifications. It is often used in click chemistry applications due to the reactivity of the azido group, allowing for the conjugation with various biomolecules. Additionally, 2-azidoadenosine can influence biological processes, including cellular signaling pathways, and may exhibit antiviral or anticancer properties. As a synthetic compound, it is typically handled with care in laboratory settings, and its stability and reactivity can be influenced by environmental conditions such as pH and temperature. Overall, 2-azidoadenosine serves as an important compound in the fields of molecular biology and medicinal chemistry.
Formula:C10H12N8O4
InChI:InChI=1/C10H12N8O4/c11-7-4-8(15-10(14-7)16-17-12)18(2-13-4)9-6(21)5(20)3(1-19)22-9/h2-3,5-6,9,19-21H,1H2,(H2,11,14,15)/t3-,5-,6-,9-/m1/s1
SMILES:C([C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)nc(nc23)N=[N+]=[NH-])O1)O)O)O
Synonyms:- Adenosine, 2-Azido-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Azidoadenosine
CAS:2-Azidoadenosine is a nucleoside analog of adenosine, where the 2'-hydroxyl group of the ribose sugar is replaced with an azido group (–N₃). This substitution imparts unique chemical properties, notably enabling molecules to undergo bioorthogonal reactions, such as click chemistry, which involves the cycloaddition of the azide group with alkynes.
Formula:C10H12H8O4Purity:Min. 95%Color and Shape:PowderMolecular weight:308.25 g/mol2-Azido Adenosine
CAS:Controlled ProductFormula:C10H12N8O4Color and Shape:NeatMolecular weight:308.252-Azido-adenosine
CAS:2-Azido-adenosine is a click chemistry reagent featuring an azide group. This compound undergoes a copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing an alkyne group. Additionally, it can react with molecules having DBCO or BCN groups through a strain-promoted alkyne-azide cycloaddition (SPAAC).
Formula:C10H12N8O4Color and Shape:SolidMolecular weight:308.25



