CAS 5959-39-7

Phenol, 2-amino-4,6-dichloro-, hydrochloride (1:1)

Description:

Phenol, 2-amino-4,6-dichloro-, hydrochloride (1:1), with the CAS number 5959-39-7, is a chemical compound characterized by its aromatic structure, which includes a phenolic group and an amino group. This compound features two chlorine substituents at the 4 and 6 positions of the phenol ring, contributing to its unique reactivity and properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and facilitates its use in various applications. The presence of the amino group imparts basic characteristics, allowing it to participate in various chemical reactions, including nucleophilic substitutions. This compound is often utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Additionally, due to the chlorine substituents, it may exhibit specific biological activities, making it of interest in medicinal chemistry. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.

Formula: C₆H₅Cl₂NO·ClH

InChI: InChI=1S/C6H5Cl2NO.ClH/c7-3-1-4(8)6(10)5(9)2-3;/h1-2,10H,9H2;1H

InChI key: InChIKey=KERIIOGUYVYCCE-UHFFFAOYSA-N

SMILES: OC1=C(Cl)C=C(Cl)C=C1N.Cl

Synonyms:

• 2-Amino-4,6-Dichlorophenol Hydrochloride (1:1)
• Phenol, 2-amino-4,6-dichloro-, hydrochloride
• Phenol, 2-amino-4,6-dichloro-, hydrochloride (1:1)
• 2-Amino-4,6-dichlorophenol hydrochloride

2-amino-4,6-dichlorophenol hydrochloride

CAS: 5959-39-7

2-amino-4,6-dichlorophenol hydrochloride

Color and Shape: White

Ref: 47-12