CAS 59608-01-4

3-(3-Pyridinyl)-2-propynoic acid

Description:

3-(3-Pyridinyl)-2-propynoic acid, with the CAS number 59608-01-4, is an organic compound characterized by its unique structure that includes a pyridine ring and a propynoic acid moiety. This compound features a triple bond between the second and third carbon atoms of the propynoic acid chain, contributing to its reactivity and potential applications in organic synthesis. The presence of the pyridine ring imparts basic properties and can influence the compound's solubility and interaction with biological systems. Typically, compounds like this may exhibit moderate to high polarity due to the carboxylic acid functional group, which can participate in hydrogen bonding. Additionally, the compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyridine derivatives. Its synthesis and reactivity can be explored in various chemical reactions, making it a valuable compound in research and industrial applications.

Formula: C₈H₅NO₂

InChI: InChI=1S/C8H5NO2/c10-8(11)4-3-7-2-1-5-9-6-7/h1-2,5-6H,(H,10,11)

InChI key: InChIKey=WGCAHZOLQMSYJH-UHFFFAOYSA-N

SMILES: C(#CC(O)=O)C=1C=CC=NC1

Synonyms:

• 2-Propynoic Acid, 3-(3-Pyridinyl)-
• 3-(3-Pyridinyl)-2-propynoic acid
• 3-(Pyridin-3-yl)-2-propynoic acid
• 3-Pyridinylpropiolic acid
• NSC 365172
• 3-(Pyridin-3-yl)prop-2-ynoic acid

3-(Pyridin-3-yl)propiolic acid

CAS: 59608-01-4

Formula: C₈H₅NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 147.1308

Ref: IN-DA00EIGB

3-(3-Pyridyl)propiolic acid

CAS: 59608-01-4

3-(3-Pyridyl)propiolic acid

Purity: 95%

Molecular weight: 147.13g/mol

Ref: 54-OR470617

3-(Pyridin-3-yl)propiolic acid

CAS: 59608-01-4

Formula: C₈H₅NO₂

Purity: 98%

Molecular weight: 147.133

Ref: 10-F434442

3-(3-Pyridyl)propiolic acid

CAS: 59608-01-4

Versatile small molecule scaffold

Formula: C₈H₅NO₂

Purity: Min. 95%

Molecular weight: 147.13 g/mol

Ref: 3D-JCA60801