CAS 5961-33-1
:3-methyl-3-phenylazetidine
Description:
3-Methyl-3-phenylazetidine is a cyclic amine characterized by a four-membered ring structure containing a nitrogen atom. This compound features a methyl group and a phenyl group attached to the nitrogen atom, contributing to its unique properties. The presence of the phenyl group enhances its aromatic characteristics, while the methyl group influences its steric and electronic properties. Typically, azetidines exhibit moderate to low polarity, which can affect their solubility in various solvents. The compound may participate in various chemical reactions, including nucleophilic substitutions and ring-opening reactions, due to the strain inherent in the four-membered ring. Additionally, 3-methyl-3-phenylazetidine may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in the synthesis of more complex organic molecules. As with many nitrogen-containing heterocycles, the stability and reactivity of 3-methyl-3-phenylazetidine can be influenced by environmental factors such as temperature and pH.
Formula:C10H13N
InChI:InChI=1/C10H13N/c1-10(7-11-8-10)9-5-3-2-4-6-9/h2-6,11H,7-8H2,1H3
SMILES:CC1(CNC1)c1ccccc1
Synonyms:- Azetidine, 3-Methyl-3-Phenyl-
- 3-Methyl-3-phenylazetidine
- L-1834
- 3-Methyl-3-phenyl-azetidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Methyl-3-phenylazetidine
CAS:Controlled Product<p>Applications A chemical constituent of the essential oils of Pteroxygonum giraldii and Polygonum amplexicaule. It showed slight sympathomimetic effects in animals during pharmacology studies.<br>References Yang, Z. et al.: Xibei Zhiwu Xuebao, 27, 1261 (2007); Bianchi, B. et al.: Farmaco Ed. Sci., 21, 131 (1966);<br></p>Formula:C10H13NColor and Shape:NeatMolecular weight:147.217
