CAS 5961-83-1

3,3'-oxydipropanoic acid

Description:

3,3'-Oxydipropanoic acid, with the CAS number 5961-83-1, is a dicarboxylic acid characterized by the presence of two carboxylic acid functional groups (-COOH) and an ether linkage (-O-) connecting two propanoic acid units. This compound typically appears as a white crystalline solid and is soluble in water due to its polar functional groups. Its molecular structure allows for potential applications in the synthesis of polymers, surfactants, and other chemical intermediates. The presence of the ether oxygen can influence its reactivity and interaction with other molecules, making it a versatile compound in organic synthesis. Additionally, 3,3'-oxydipropanoic acid may exhibit properties such as moderate acidity, which can be relevant in various chemical reactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, its unique structure and properties make it of interest in both industrial and research settings.

Formula: C₆H₁₀O₅

InChI: InChI=1/C6H10O5/c7-5(8)1-3-11-4-2-6(9)10/h1-4H2,(H,7,8)(H,9,10)

SMILES: C(COCCC(=O)O)C(=O)O

Propanoic acid, 3,3'-oxybis-

CAS: 5961-83-1

Formula: C₆H₁₀O₅

Purity: 95%

Color and Shape: Solid

Molecular weight: 162.1406

Ref: IN-DA00IAKT

Bis-PEG1-acid

CAS: 5961-83-1

Bis-PEG1-acid

Purity: 95%

Molecular weight: 162.14g/mol

Ref: 54-BIPG1246

Bis-PEG1-acid

CAS: 5961-83-1

Bis-PEG1-acid is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.

Formula: C₆H₁₀O₅

Color and Shape: Solid

Molecular weight: 162.14

Ref: TM-T14626

3,3′-OXYDIPROPANOIC ACID

CAS: 5961-83-1

Formula: C₆H₁₀O₅

Purity: 95%

Color and Shape: Solid

Molecular weight: 162.141

Ref: 10-F474367

3,3-oxydipropanoic acid

CAS: 5961-83-1

Versatile small molecule scaffold

Formula: C₆H₁₀O₅

Purity: Min. 95%

Molecular weight: 162.14 g/mol

Ref: 3D-FAA96183