CAS 59614-95-8
:4-chlorothiophene-2-carboxylic acid
Description:
4-Chlorothiophene-2-carboxylic acid is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of a carboxylic acid group (-COOH) at the 2-position and a chlorine atom at the 4-position on the thiophene ring contributes to its chemical reactivity and properties. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to the carboxylic acid functionality. It exhibits acidic behavior, capable of donating a proton in solution. The chlorine substituent can influence the compound's electronic properties, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. 4-Chlorothiophene-2-carboxylic acid is often utilized in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals, owing to its ability to serve as a building block in organic synthesis. Its unique structure allows for potential applications in materials science and as an intermediate in the production of more complex molecules.
Formula:C5H3ClO2S
InChI:InChI=1/C5H3ClO2S/c6-3-1-4(5(7)8)9-2-3/h1-2H,(H,7,8)
SMILES:c1c(csc1C(=O)O)Cl
Synonyms:- 2-Thiophenecarboxylic Acid, 4-Chloro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Chlorothiophene-2-carboxylic acid
CAS:Formula:C5H3ClO2SPurity:96%Color and Shape:SolidMolecular weight:162.59414-Chlorothiophene-2-carboxylic acid
CAS:4-Chlorothiophene-2-carboxylic acidFormula:C5H3ClO2SPurity:95%Color and Shape: white to off-white solidMolecular weight:162.59g/mol4-Chlorothiophene-2-carboxylic Acid
CAS:Controlled ProductFormula:C5H3ClO2SColor and Shape:NeatMolecular weight:162.594-Chlorothiophene-2- carboxylic acid
CAS:Formula:C5H3ClO2SPurity:96%Color and Shape:SolidMolecular weight:162.594-Chlorothiophene-2- carboxylic acid
CAS:4-Chlorothiophene-2-carboxylic acid is a chemical compound that belongs to the group of carboxylic acids. The synthesis of this compound is regioselective, which means that it can be synthesized in only one possible stereoisomer. 4-Chlorothiophene-2-carboxylic acid is used as an intermediate for pharmaceutical products and as a medicament, which has been shown to have trackable properties. This compound has also been shown to inhibit the interaction between anions and cations, which may lead to the development of new drugs.Formula:C5H3ClO2SPurity:Min. 95%Molecular weight:162.59 g/mol




