CAS 5963-77-9
:2-Pentynoic acid
Description:
2-Pentynoic acid, with the CAS number 5963-77-9, is an alkyne carboxylic acid characterized by a five-carbon chain featuring a triple bond between the second and third carbon atoms. This compound has a molecular formula of C5H6O2 and is known for its distinctive properties. It typically appears as a colorless to pale yellow liquid with a pungent odor. The presence of the carboxylic acid functional group (-COOH) imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. 2-Pentynoic acid is soluble in organic solvents and exhibits limited solubility in water due to its hydrophobic carbon chain. Its reactivity is influenced by the triple bond, making it a useful intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Additionally, it can undergo polymerization and other transformations, showcasing its versatility in chemical applications. Safety precautions should be taken when handling this compound, as it may cause irritation to the skin and eyes.
Formula:C5H6O2
InChI:InChI=1/C5H6O2/c1-2-3-4-5(6)7/h2H2,1H3,(H,6,7)
SMILES:CCC#CC(=O)O
Synonyms:- Pent-2-Ynoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Pentynoic acid, 97%
CAS:2-Pentynoic acid is used in the stereoselective synthesis of vinylstannanes. It is also used in the synthesis of spiroindolines derivatives. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to tFormula:C5H6O2Purity:97%Molecular weight:98.12-Pentynoic acid
CAS:2-Pentynoic acidFormula:C5H6O2Purity:97%Color and Shape: off-white to faint brown crystalline solidMolecular weight:98.10g/mol2-Pentynoic acid
CAS:2-Pentynoic acid (2PA) is an organic compound that belongs to the group of reactive oxygen species. It is a fluorophore and has been extensively used as a reagent in biochemical and biophysical research. 2PA has been shown to induce muscle cell proliferation through activation of the Toll-like receptor 4, which may be due to its ability to cause nucleophilic attack on proteins. 2PA is also involved in metabolic disorders such as diabetes mellitus type II, where it promotes insulin secretion by activating the enzyme catalysis of phospholipase A2.Formula:C5H6O2Purity:Min. 95%Molecular weight:98.1 g/mol




