CAS 59641-25-7
:2-chloro-3-pyrrolidino-1,4-naphthoquinone
Description:
2-Chloro-3-pyrrolidino-1,4-naphthoquinone is a synthetic organic compound characterized by its naphthoquinone structure, which features a naphthalene ring system with two ketone groups. The presence of a chlorine atom at the 2-position and a pyrrolidine ring at the 3-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and exhibits a distinct color, often associated with quinones. It is known for its potential biological activity, including antimicrobial and anticancer properties, making it of interest in medicinal chemistry. The compound's reactivity is influenced by the electron-withdrawing nature of the chlorine atom and the nucleophilic character of the pyrrolidine moiety, which can participate in various chemical reactions. Additionally, its solubility may vary depending on the solvent, often being more soluble in organic solvents than in water. Safety precautions should be taken when handling this compound, as it may pose health risks due to its reactive nature and potential toxicity.
Formula:C14H12ClNO2
InChI:InChI=1/C14H12ClNO2/c15-11-12(16-7-3-4-8-16)14(18)10-6-2-1-5-9(10)13(11)17/h1-2,5-6H,3-4,7-8H2
SMILES:c1ccc2c(c1)C(=O)C(=C(C2=O)N1CCCC1)Cl
Synonyms:- 2-Chloro-3-(Pyrrolidin-1-Yl)Naphthalene-1,4-Dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Chloro-3-(pyrrolidin-1-yl)-1,4-dihydronaphthalene-1,4-dione
CAS:2-Chloro-3-(pyrrolidin-1-yl)-1,4-dihydronaphthalene-1,4-dionePurity:techMolecular weight:261.70g/mol
