CAS 59642-21-6
:N-(4-Nitrobenzoyl)-β-alanine
Description:
N-(4-Nitrobenzoyl)-β-alanine, with the CAS number 59642-21-6, is an organic compound characterized by its structure, which includes a β-alanine moiety linked to a 4-nitrobenzoyl group. This compound typically appears as a solid and is known for its potential applications in biochemical research, particularly in studies involving amino acids and peptide synthesis. The presence of the nitro group contributes to its electronic properties, making it a useful intermediate in organic synthesis. Additionally, the compound may exhibit specific reactivity patterns due to the functional groups present, which can influence its behavior in various chemical reactions. Its solubility can vary depending on the solvent used, and it may display distinct spectral characteristics in techniques such as UV-Vis and NMR spectroscopy. Overall, N-(4-Nitrobenzoyl)-β-alanine serves as a valuable compound in the field of medicinal chemistry and biochemistry, facilitating the exploration of new therapeutic agents and biochemical pathways.
Formula:C10H10N2O5
InChI:InChI=1S/C10H10N2O5/c13-9(14)5-6-11-10(15)7-1-3-8(4-2-7)12(16)17/h1-4H,5-6H2,(H,11,15)(H,13,14)
InChI key:InChIKey=PDTLZWITKYGYDN-UHFFFAOYSA-N
SMILES:C(NCCC(O)=O)(=O)C1=CC=C(N(=O)=O)C=C1
Synonyms:- 3-[(4-Nitrophenyl)formamido]propanoic acid
- 3-{[(4-Nitrophenyl)Carbonyl]Amino}Propanoate
- N-(4-Nitrobenzoyl)-?alanine
- N-(4-Nitrobenzoyl)-β-alanine
- N-(4-nitrobenzoyl)-beta-alanine
- β-Alanine, N-(4-nitrobenzoyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
b-Alanine, N-(4-nitrobenzoyl)-
CAS:Formula:C10H10N2O5Purity:98%Color and Shape:SolidMolecular weight:238.1968N-(4-Nitrobenzoyl)-β-alanine
CAS:Formula:C10H10N2O5Purity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:238.20N-(4-Nitrobenzoyl)-beta-alanine
CAS:N-(4-Nitrobenzoyl)-beta-alanine is a synthetic compound that can be used for the treatment of inflammatory bowel disease. This drug is synthesized by reacting 4-nitrobenzoyl chloride with beta-alanine in an organic solvent such as ethyl acetate or cyclohexanol. The reaction mixture is then filtered and crystallized to yield the desired product. The synthesis of this compound takes place at room temperature, and the reaction time can be varied depending on the desired rate of synthesis.
Formula:C10H10N2O5Purity:Min. 95%Molecular weight:238.2 g/mol






