CAS 59663-70-6

ethyl 3-aminohexanoate

Description:

Ethyl 3-aminohexanoate, with the CAS number 59663-70-6, is an organic compound characterized by its structure, which includes an ethyl ester group and an amino group attached to a hexanoic acid chain. This compound typically appears as a colorless to pale yellow liquid and is soluble in organic solvents, reflecting its ester nature. Ethyl 3-aminohexanoate is known for its potential applications in the synthesis of pharmaceuticals and agrochemicals, as well as in the development of surfactants and emulsifiers due to its amphiphilic properties. The presence of the amino group allows for further chemical modifications, making it a versatile intermediate in organic synthesis. Additionally, it may exhibit biological activity, which can be explored in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, ethyl 3-aminohexanoate is a valuable compound in various chemical applications, owing to its functional groups and structural characteristics.

Formula: C₈H₁₇NO₂

InChI: InChI=1/C8H17NO2/c1-3-5-7(9)6-8(10)11-4-2/h7H,3-6,9H2,1-2H3

SMILES: CCCC(CC(=O)OCC)N

ethyl 3-aminohexanoate hydrochloride

CAS: 59663-70-6

Formula: C₈H₁₈ClNO₂

Purity: 95.0%

Molecular weight: 195.69

Ref: 10-F359232

Ethyl 3-Aminohexanoate Hydrochloride

Controlled Product

CAS: 59663-70-6

Formula: C₈H₁₇NO₂·HCl

Color and Shape: Neat

Molecular weight: 195.687

Ref: TR-E572725