CAS 59664-03-8
:1-(7-ethyl-1-benzofuran-2-yl)ethanone
Description:
1-(7-ethyl-1-benzofuran-2-yl)ethanone, with the CAS number 59664-03-8, is an organic compound characterized by its unique structure that includes a benzofuran moiety and an ethanone functional group. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions, including electrophilic substitutions. The presence of the ethyl group enhances its hydrophobic characteristics, influencing its solubility in organic solvents. The benzofuran structure contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmacology. Additionally, the compound may exhibit fluorescence properties, which can be useful in analytical applications. Its synthesis often involves methods typical for constructing substituted benzofurans, and it may be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Overall, 1-(7-ethyl-1-benzofuran-2-yl)ethanone represents a compound with intriguing chemical properties and potential applications in various fields.
Formula:C12H12O2
InChI:InChI=1/C12H12O2/c1-3-9-5-4-6-10-7-11(8(2)13)14-12(9)10/h4-7H,3H2,1-2H3
SMILES:CCc1cccc2cc(C(=O)C)oc12
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Acetyl-7-ethylbenzofuran
CAS:Controlled Product<p>Applications Intermediate in the production of Bufuralol Hydrochloride<br></p>Formula:C12H12O2Color and Shape:NeatMolecular weight:188.22

