CAS 59665-28-0

1,2-Dibromo-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-octene

Description:

1,2-Dibromo-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-octene is a fluorinated organic compound characterized by its unique structure, which includes a long carbon chain with multiple fluorine atoms and bromine substituents. This compound features a double bond between the first and second carbon atoms, contributing to its reactivity and potential applications in various chemical processes. The presence of bromine atoms enhances its reactivity, making it useful in organic synthesis and as an intermediate in the production of other chemical compounds. The extensive fluorination imparts unique properties such as increased hydrophobicity and thermal stability, which can be advantageous in specific applications, including coatings and specialty materials. Additionally, the compound's fluorinated nature may influence its environmental persistence and bioaccumulation potential, necessitating careful consideration in terms of safety and regulatory compliance. Overall, 1,2-Dibromo-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-octene is notable for its complex structure and the implications of its halogenated features in chemical behavior and application.

Formula: C₈HBr₂F₁₃

InChI: InChI=1S/C8HBr2F13/c9-1-2(10)3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)23/h1H

InChI key: InChIKey=YCJFSPFBPAMUCR-UHFFFAOYSA-N

SMILES: C(C(C(C(F)(F)F)(F)F)(F)F)(C(C(C(=CBr)Br)(F)F)(F)F)(F)F

Synonyms:

• 1,2-Dibromo-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-octene
• 1-Octene, 1,2-dibromo-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-
• 1,2-Dibromo-1-(perfluoro-n-hexyl)ethylene
• 1,2-Dibromo-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooct-1-ene, 1,2-Dibromo-1-(perfluorohex-1-yl)ethylene
• 1,2-Dibromo-1H-tridecafluorooct-1-ene

1,2-Dibromo-1H-tridecafluorooct-1-ene

CAS: 59665-28-0

1,2-Dibromo-1H-tridecafluorooct-1-ene

Purity: 97

Molecular weight: 503.88g/mol

Ref: 54-PC51067