CAS 59666-16-9

2,7-Dichloro-4-methylquinoline

Description:

2,7-Dichloro-4-methylquinoline is an organic compound belonging to the quinoline family, characterized by a bicyclic structure containing a fused benzene and pyridine ring. This compound features two chlorine atoms at the 2 and 7 positions and a methyl group at the 4 position of the quinoline ring. It is typically a yellowish to brown solid at room temperature and is sparingly soluble in water but more soluble in organic solvents such as ethanol and acetone. The presence of chlorine substituents can influence its reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitutions. Additionally, the compound may exhibit biological activity, which is of interest in medicinal chemistry and drug development. Its unique structure allows for potential applications in the synthesis of other chemical entities or as a precursor in the development of pharmaceuticals. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks.

Formula: C₁₀H₇Cl₂N

InChI: InChI=1S/C10H7Cl2N/c1-6-4-10(12)13-9-5-7(11)2-3-8(6)9/h2-5H,1H3

InChI key: InChIKey=FTONSAARTKYOAV-UHFFFAOYSA-N

SMILES: CC=1C2=C(N=C(Cl)C1)C=C(Cl)C=C2

Synonyms:

• Quinoline, 2,7-dichloro-4-methyl-
• 2,7-Dichloro-4-methylquinoline
• 2,7-Dichloro-4-methylquinoline

2,7-Dichloro-4-methylquinoline

CAS: 59666-16-9

2,7-Dichloro-4-methylquinoline

Purity: ≥95%

Molecular weight: 212.08g/mol

Ref: 54-OR309382