CAS 596818-05-2

1-(2-Thiazolyl)-4-piperidinamine

Description:

1-(2-Thiazolyl)-4-piperidinamine is a chemical compound characterized by its unique structural features, which include a thiazole ring and a piperidine moiety. The thiazole ring contributes to its heterocyclic nature, providing potential biological activity due to its ability to participate in various chemical interactions. The piperidine part of the molecule is a six-membered ring containing one nitrogen atom, which enhances the compound's solubility and reactivity. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its molecular structure suggests that it may exhibit properties such as antimicrobial or anti-inflammatory activity, although specific biological activities would depend on further empirical studies. Additionally, the presence of both nitrogen and sulfur atoms in its structure may influence its interaction with biological targets, making it a subject of interest in drug discovery and development. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₈H₁₃N₃S

InChI: InChI=1/C8H13N3S/c9-7-1-4-11(5-2-7)8-10-3-6-12-8/h3,6-7H,1-2,4-5,9H2

SMILES: C1CN(CCC1N)c1nccs1

1-(1,3-Thiazol-2-yl)piperidin-4-amine

CAS: 596818-05-2

Versatile small molecule scaffold

Formula: C₈H₁₃N₃S

Purity: Min. 95%

Molecular weight: 183.28 g/mol

Ref: 3D-WYA81805