CAS 59686-39-4
:ethyl 2-chloro-4-methyl-6-tetrahydro-1H-pyrrol-1-ylbenzoate
Description:
Ethyl 2-chloro-4-methyl-6-tetrahydro-1H-pyrrol-1-ylbenzoate, with the CAS number 59686-39-4, is a chemical compound that belongs to the class of benzoates, which are esters derived from benzoic acid. This compound features a chloro substituent and a tetrahydro-pyrrole moiety, contributing to its unique structural characteristics. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the ethyl ester group suggests it may exhibit moderate solubility in organic solvents while being less soluble in water. Its molecular structure indicates potential biological activity, making it of interest in pharmaceutical and agrochemical research. The chloro and methyl groups can influence its reactivity and interaction with biological systems. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, ethyl 2-chloro-4-methyl-6-tetrahydro-1H-pyrrol-1-ylbenzoate represents a complex organic molecule with potential applications in various fields.
Formula:C14H18ClNO2
InChI:InChI=1/C14H18ClNO2/c1-3-18-14(17)13-11(15)8-10(2)9-12(13)16-6-4-5-7-16/h8-9H,3-7H2,1-2H3
SMILES:CCOC(=O)c1c(cc(C)cc1N1CCCC1)Cl
Synonyms:- Ethyl 2-chloro-4-methyl-6-(1-pyrrolidinyl)benzoate
- Et-Cmpb
- Benzoic acid, 2-chloro-4-methyl-6-(1-pyrrolidinyl)-, ethyl ester
- Ethyl 2-Chloro-4-Methyl-6-Pyrrolidin-1-Ylbenzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ethyl 2-chloro-4-methyl-6-tetrahydro-1H-pyrrol-1-ylbenzoate
CAS:Ethyl 2-chloro-4-methyl-6-tetrahydro-1H-pyrrol-1-ylbenzoate
Molecular weight:267.75g/mol
