CymitQuimica logo

CAS 597-72-8

:

Tetrapropoxymethane; 95%

Description:
Tetrapropoxymethane, also known as tetrapropyl orthosilicate, is an organosilicon compound characterized by its four propoxy groups attached to a central carbon atom. This compound typically appears as a colorless to pale yellow liquid with a mild odor. It is soluble in organic solvents but has limited solubility in water. Tetrapropoxymethane is primarily used as a precursor in the synthesis of silica and as a coupling agent in various chemical processes. Its reactivity is influenced by the presence of the propoxy groups, which can undergo hydrolysis and condensation reactions, leading to the formation of siloxane networks. The compound is generally considered to have low toxicity, but appropriate safety measures should be taken when handling it, as it can cause irritation to the skin and eyes. In industrial applications, it is valued for its ability to enhance the properties of materials, such as improving adhesion and durability in coatings and sealants.
Formula:C13H28O4
InChI:InChI=1/C13H28O4/c1-5-9-14-13(15-10-6-2,16-11-7-3)17-12-8-4/h5-12H2,1-4H3
InChI key:LFMXSZSVDQJYDU-UHFFFAOYSA-N
SMILES:CCCOC(OCCC)(OCCC)OCCC
Synonyms:
  • Tetra-n-propoxymethane
  • 1-(Tripropoxymethoxy)Propane
Found 2 products.