CAS 59719-78-7
:4-tert-butyl-3-nitrobenzoic acid
Description:
4-tert-butyl-3-nitrobenzoic acid is an aromatic carboxylic acid characterized by the presence of a nitro group and a tert-butyl substituent on the benzene ring. Its molecular structure features a benzoic acid core, with the tert-butyl group located at the para position relative to the carboxylic acid group and the nitro group at the meta position. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents, while its solubility in water is limited due to the hydrophobic tert-butyl group. The presence of the nitro group contributes to its electron-withdrawing properties, influencing its reactivity and acidity. As a benzoic acid derivative, it can participate in various chemical reactions, including esterification and nucleophilic substitution. Its applications may extend to fields such as pharmaceuticals, agrochemicals, and materials science, where it can serve as an intermediate or a building block for more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C11H13NO4
InChI:InChI=1/C11H13NO4/c1-11(2,3)8-5-4-7(10(13)14)6-9(8)12(15)16/h4-6H,1-3H3,(H,13,14)
SMILES:CC(C)(C)c1ccc(cc1N(=O)=O)C(=O)O
Synonyms:- Benzoic Acid, 4-(1,1-Dimethylethyl)-3-Nitro-
- 4-(tert-butyl)-3-nitrobenzoic acid
- 4-tert-Butyl-3-nitrobenzoic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-tert-butyl-3-nitrobenzoic acid
CAS:Formula:C11H13NO4Purity:98%Color and Shape:SolidMolecular weight:223.22524-(tert-Butyl)-3-nitrobenzoic acid
CAS:4-(tert-Butyl)-3-nitrobenzoic acidPurity:98%Molecular weight:223.22522g/mol4-tert-butyl-3-nitrobenzoic acid
CAS:4-tert-butyl-3-nitrobenzoic acid is an inorganic compound that has been used as a semiconductor material. It is a programmable material that can be fabricated to have properties that can be changed by exposing it to radiation, such as electron beams or x-rays. 4-tert-butyl-3-nitrobenzoic acid has been studied for use in fabricating solar cells, transistors, and diodes. The compound has shown high growth rates and functionalities when it is exposed to silver ions or germanium. The ligands of the compound have also been optimized for use with organic materials.Formula:C11H13NO4Purity:Min. 95%Molecular weight:223.2 g/mol



