CAS 59724-83-3

{[(4-chlorophenyl)sulfonyl](methyl)amino}acetate

Description:

{[(4-chlorophenyl)sulfonyl](methyl)amino}acetate, with the CAS number 59724-83-3, is a chemical compound characterized by its sulfonamide functional group, which is linked to a 4-chlorophenyl moiety. This compound typically exhibits properties associated with sulfonamides, such as potential antibacterial activity, although its specific biological activity may vary. The presence of the acetate group suggests that it may have solubility in polar solvents and could participate in various chemical reactions, including esterification and hydrolysis. The 4-chlorophenyl group may influence its electronic properties and reactivity, potentially enhancing its interaction with biological targets. Additionally, the methylamino group indicates that it may engage in hydrogen bonding, affecting its solubility and reactivity. Overall, this compound's characteristics make it of interest in medicinal chemistry and pharmaceutical research, particularly in the development of new therapeutic agents. However, detailed studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₉H₉ClNO₄S

InChI: InChI=1/C9H10ClNO4S/c1-11(6-9(12)13)16(14,15)8-4-2-7(10)3-5-8/h2-5H,6H2,1H3,(H,12,13)/p-1

SMILES: CN(CC(=O)[O-])S(=O)(=O)c1ccc(cc1)Cl

2-(N-Methyl4-chlorobenzenesulfonamido)acetic acid

CAS: 59724-83-3

Versatile small molecule scaffold

Formula: C₉H₁₀ClNO₄S

Purity: Min. 95%

Molecular weight: 263.7 g/mol

Ref: 3D-JCA72483