CAS 59724-85-5

2,2'-{[(4-methylphenyl)sulfonyl]imino}diacetic acid

Description:

2,2'-{[(4-methylphenyl)sulfonyl]imino}diacetic acid, identified by its CAS number 59724-85-5, is an organic compound characterized by the presence of a sulfonamide functional group and two carboxylic acid groups. This compound features a diacetic acid backbone, which contributes to its acidity and potential reactivity in various chemical environments. The sulfonyl group, derived from 4-methylphenyl, enhances the compound's solubility in polar solvents and may influence its biological activity. The presence of the methyl group on the phenyl ring can affect the compound's steric and electronic properties, potentially impacting its interactions with biological targets or other chemical species. As a diacid, it can participate in acid-base reactions and form salts or esters. The compound's structure suggests potential applications in pharmaceuticals, agrochemicals, or as a reagent in organic synthesis, although specific applications would depend on further research into its properties and reactivity. Overall, this compound exemplifies the complexity and versatility of organic molecules in chemical and biological contexts.

Formula: C₁₁H₁₃NO₆S

InChI: InChI=1/C11H13NO6S/c1-8-2-4-9(5-3-8)19(17,18)12(6-10(13)14)7-11(15)16/h2-5H,6-7H2,1H3,(H,13,14)(H,15,16)

SMILES: Cc1ccc(cc1)S(=O)(=O)N(CC(=O)O)CC(=O)O

Synonyms:

• {(Carboxymethyl)[(4-Methylphenyl)Sulfonyl]Amino}Acetic Acid
• glycine, N-(carboxymethyl)-N-[(4-methylphenyl)sulfonyl]-

2-[N-(Carboxymethyl)4-methylbenzenesulfonamido]acetic acid

CAS: 59724-85-5

Versatile small molecule scaffold

Formula: C₁₁H₁₁NO₆S

Purity: Min. 95%

Molecular weight: 285.28 g/mol

Ref: 3D-JCA72485