CAS 5974-93-6
:1-[(2R,5S)-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]pyrimidine-2,4(1H,3H)-dione
Description:
The chemical substance known as 1-[(2R,5S)-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]pyrimidine-2,4(1H,3H)-dione, with the CAS number 5974-93-6, is a pyrimidine derivative characterized by its unique bicyclic structure that incorporates both a pyrimidine ring and a dihydrofuran moiety. This compound features a hydroxymethyl group, which contributes to its potential reactivity and solubility in polar solvents. The presence of the hydroxymethyl group and the specific stereochemistry indicated by the (2R,5S) configuration suggests that this compound may exhibit interesting biological activities, possibly acting as a pharmaceutical agent or a biochemical probe. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its behavior in biological systems. Additionally, the compound's stability and reactivity can be affected by environmental conditions such as pH and temperature, making it a subject of interest in medicinal chemistry and drug development.
Formula:C9H10N2O4
InChI:InChI=1/C9H10N2O4/c12-5-6-1-2-8(15-6)11-4-3-7(13)10-9(11)14/h1-4,6,8,12H,5H2,(H,10,13,14)/t6-,8+/m0/s1
Synonyms:- 2,4(1H,3H)-pyrimidinedione, 1-[(2R,5S)-2,5-dihydro-5-(hydroxymethyl)-2-furanyl]-
- 5-[(2R,5S)-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]pyrimidine-2,4(1H,3H)-dione
- 1-(2,3-Dideoxy-beta-d-glyceropent-2-enofuranosyl)uracil
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1-(2,3-DIDEOXY-β-D-GLYCEROPENT-2-ENOFURANOSYL)URACIL
CAS:Formula:C9H10N2O4Purity:97%Molecular weight:210.18671-((2R,5S)-5-(Hydroxymethyl)-2,5-dihydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione
CAS:1-((2R,5S)-5-(Hydroxymethyl)-2,5-dihydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dionePurity:97%Molecular weight:210.19g/mol2',3'-Dideoxy-2',3'-didehydro-uridine
CAS:Nucleoside Derivatives - Didehydro-nucleosideFormula:C9H10N2O4Color and Shape:SolidMolecular weight:210.192',3'-Didehydro-2',3'-dideoxyuridine
CAS:<p>2',3'-Didehydro-2',3'-dideoxyuridine (DDDU) is a nucleoside analog that inhibits the formation of HIV. It is a potent inhibitor of human immunodeficiency virus type 1 (HIV-1) replication in cell culture, and has been shown to inhibit the production of HIV-1 virions in vitro. 2',3'-Didehydro-2',3'-dideoxyuridine has been shown to bind to the enzyme glycosyltransferase, which is required for HIV-1 replication. DDU also binds to human CD4+ T cells, deflecting them from the HIV-infected target cell. This compound may be useful as an antiviral agent against HIV-1 infection by inhibiting viral replication and infectivity.</p>Formula:C9H10N2O4Purity:Min. 95%Molecular weight:210.19 g/mol






