CAS 59741-17-2
:2-methoxy-5-nitrophenyl isocyanate
Description:
2-Methoxy-5-nitrophenyl isocyanate is an organic compound characterized by the presence of an isocyanate functional group (-N=C=O) attached to a phenyl ring that is further substituted with a methoxy group (-OCH3) and a nitro group (-NO2). This compound typically appears as a yellow to brown solid and is known for its reactivity, particularly in nucleophilic addition reactions due to the electrophilic nature of the isocyanate group. The methoxy group can influence the electronic properties of the phenyl ring, potentially enhancing its reactivity in various chemical transformations. The nitro group, being a strong electron-withdrawing group, can also affect the compound's reactivity and stability. 2-Methoxy-5-nitrophenyl isocyanate is utilized in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. Safety precautions should be observed when handling this compound, as isocyanates are known to be toxic and can cause respiratory irritation.
Formula:C8H6N2O4
InChI:InChI=1/C8H6N2O4/c1-14-8-3-2-6(10(12)13)4-7(8)9-5-11/h2-4H,1H3
SMILES:COc1ccc(cc1N=C=O)N(=O)=O
Synonyms:- 2-Isocyanato-1-Methoxy-4-Nitrobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
