CAS 59748-90-2
:4-Bromo-2-chlorobenzoic acid
Description:
4-Bromo-2-chlorobenzoic acid is an aromatic carboxylic acid characterized by the presence of both bromine and chlorine substituents on the benzene ring. Specifically, it features a bromine atom at the para position (4-position) and a chlorine atom at the ortho position (2-position) relative to the carboxylic acid group. This compound is typically a white to off-white solid at room temperature and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water due to its hydrophobic aromatic structure. The presence of halogen atoms can influence its reactivity, making it useful in various chemical syntheses, including the preparation of pharmaceuticals and agrochemicals. Additionally, 4-Bromo-2-chlorobenzoic acid can participate in electrophilic aromatic substitution reactions, and its derivatives may exhibit interesting biological activities. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C7H4BrClO2
InChI:InChI=1S/C7H4BrClO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,(H,10,11)
InChI key:InChIKey=JAVZWSOFJKYSDY-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(Cl)C=C(Br)C=C1
Synonyms:- 2-Chloro-4-Bromobenzoic Acid
- 4-Bromo-2-Chlorobenzoic Acid 98+%
- Benzoic acid, 4-bromo-2-chloro-
- Rarechem Al Bo 2371
- 4-Bromo-2-chlorobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
4-Bromo-2-chlorobenzoic Acid
CAS:Formula:C7H4BrClO2Purity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:235.464-Bromo-2-chlorobenzoic acid
CAS:Formula:C7H4BrClO2Purity:98%Color and Shape:SolidMolecular weight:235.4625Ref: IN-DA003KWA
1g20.00€5g25.00€10g28.00€1kg525.00€25g41.00€50g61.00€100g91.00€10kgTo inquire250g171.00€25kgTo inquire500g234.00€4-Bromo-2-chlorobenzoic acid
CAS:4-Bromo-2-chlorobenzoic acidFormula:C7H4BrClO2Purity:≥95%Color and Shape: off-white solidMolecular weight:235.46246g/mol4-Bromo-2-chlorobenzoic acid
CAS:4-Bromo-2-chlorobenzoic acid is a halogen and has been shown to interact with the brain. It interacts with quinacrine, which is an antimalarial drug, in vivo studies. 4-Bromo-2-chlorobenzoic acid also interacts with other drugs such as tetracycline and erythromycin. 4-Bromo-2-chlorobenzoic acid is used for the synthesis of new compounds, such as quinacrine, which are useful for treating malaria. This compound can be synthesized using a cross coupling reaction that utilizes palladium as a catalyst.Formula:C7H4BrClO2Purity:Min. 95%Color and Shape:PowderMolecular weight:235.46 g/mol4-Bromo-2-chlorobenzoic acid
CAS:Formula:C7H4BrClO2Purity:98%Color and Shape:SolidMolecular weight:235.464-Bromo-2-chlorobenzoic Acid
CAS:Controlled ProductImpurity Mefenamic Acid EP Impurity C
Applications 4-Bromo-2-chlorobenzoic Acid (cas# 59748-90-2) is a compound useful in organic synthesis.Formula:C7H4BrClO2Color and Shape:NeatMolecular weight:235.46







