CAS 59749-96-1
:3-amino-N-phenyl-3-thioxopropanamide
Description:
3-amino-N-phenyl-3-thioxopropanamide, identified by its CAS number 59749-96-1, is an organic compound characterized by the presence of an amine group, a phenyl group, and a thioxo (sulfur-containing) moiety. This compound typically exhibits properties associated with both amides and thioketones, which can influence its reactivity and interactions. The amino group can participate in hydrogen bonding, enhancing solubility in polar solvents, while the thioxo group may impart unique chemical reactivity, such as potential nucleophilic behavior. The phenyl group contributes to the compound's hydrophobic character and can affect its overall stability and reactivity. In terms of applications, compounds of this nature may be explored in medicinal chemistry for their potential biological activities, including antimicrobial or anticancer properties. However, specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise values. Overall, 3-amino-N-phenyl-3-thioxopropanamide represents a versatile structure with potential implications in various chemical and pharmaceutical contexts.
Formula:C9H10N2OS
InChI:InChI=1/C9H10N2OS/c10-8(13)6-9(12)11-7-4-2-1-3-5-7/h1-5H,6H2,(H2,10,13)(H,11,12)
SMILES:c1ccc(cc1)N=C(CC(=N)S)O
Synonyms:- propanamide, 3-amino-N-phenyl-3-thioxo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-Carbamothioyl-N-phenylacetamide
CAS:2-Carbamothioyl-N-phenylacetamide is a basic compound that reacts with sodium hydroxide to form the corresponding amide. It is used in the synthesis of other compounds, including xanthine and caffeine. 2-Carbamothioyl-N-phenylacetamide can be prepared by reacting phenylacetic acid with thiourea in the presence of ethanol, followed by hydrolysis with sodium hydroxide. The product can also be obtained by heating xanthine in aqueous solution with sodium hydroxide and ethanol. This reaction is shown in figure 1 below.Formula:C9H10N2OSPurity:Min. 95%Molecular weight:194.26 g/mol
