CAS 597545-23-8

[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid

Description:

[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid is a chemical compound characterized by its unique structure, which includes an oxadiazole ring and a sulfanyl group attached to an acetic acid moiety. The presence of the 1,3,4-oxadiazole ring contributes to its potential biological activity, as oxadiazoles are known for their diverse pharmacological properties. The ethyl group enhances the lipophilicity of the molecule, potentially influencing its solubility and permeability. The sulfanyl group introduces a thiol functionality, which can participate in various chemical reactions, including nucleophilic substitutions and redox reactions. This compound may exhibit interesting interactions with biological targets, making it a candidate for further research in medicinal chemistry. Its specific properties, such as melting point, solubility, and reactivity, would depend on the molecular environment and conditions under which it is studied. Overall, [(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid represents a class of compounds that could have applications in pharmaceuticals or agrochemicals.

Formula: C₆H₈N₂O₃S

InChI: InChI=1/C6H8N2O3S/c1-2-4-7-8-6(11-4)12-3-5(9)10/h2-3H2,1H3,(H,9,10)

SMILES: CCc1nnc(o1)SCC(=O)O

[(5-ethyl-1,3,4-oxadiazol-2-yl)thio]acetic acid hydrate

CAS: 597545-23-8

Formula: C₆H₁₀N₂O₄S

Purity: 95.0%

Color and Shape: Liquid

Molecular weight: 206.22

Ref: 10-F359217