CymitQuimica logo

CAS 597551-56-9

:

2-chloro-5-iodo-pyrimidin-4-amine

Description:
2-Chloro-5-iodo-pyrimidin-4-amine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a chlorine atom at the 2-position, an iodine atom at the 5-position, and an amino group at the 4-position. This compound is typically a solid at room temperature and may exhibit a crystalline structure. It is polar due to the presence of the amino group, which can participate in hydrogen bonding, influencing its solubility in polar solvents. The presence of halogens (chlorine and iodine) can impart unique reactivity, making it useful in various chemical syntheses, particularly in medicinal chemistry and agrochemical applications. The compound may also exhibit biological activity, potentially serving as a precursor or intermediate in the development of pharmaceuticals. Its stability and reactivity can be influenced by the electronic effects of the halogen substituents, which can affect the compound's overall chemical behavior. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C4H3ClIN3
InChI:InChI=1/C4H3ClIN3/c5-4-8-1-2(6)3(7)9-4/h1H,(H2,7,8,9)
InChI key:RAMOUFDZSBRIGR-UHFFFAOYSA-N
SMILES:c1c(c(=N)[nH]c(Cl)n1)I
Synonyms:
  • 2-Chloro-5-iodopyrimidin-4-amine
  • 4-Pyrimidinamine, 2-Chloro-5-Iodo-
Found 4 products.