CAS 59782-85-3

2,5-Dichloronicotinic acid

Description:

2,5-Dichloronicotinic acid is a chemical compound characterized by its pyridine ring structure, which is substituted with two chlorine atoms at the 2 and 5 positions and a carboxylic acid group at the 3 position. This compound is a derivative of nicotinic acid, exhibiting both acidic and polar properties due to the presence of the carboxylic acid functional group. It is typically a white to off-white crystalline solid that is soluble in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. The presence of chlorine atoms enhances its reactivity and can influence its biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. 2,5-Dichloronicotinic acid can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which are valuable in synthetic organic chemistry. Additionally, its structural features may contribute to its potential applications in medicinal chemistry, particularly in the development of compounds with specific biological activities.

Formula: C₆H₃Cl₂NO₂

InChI: InChI=1/C6H3Cl2NO2/c7-3-1-4(6(10)11)5(8)9-2-3/h1-2H,(H,10,11)

SMILES: c1c(cnc(c1C(=O)O)Cl)Cl

Synonyms:

• 2,5-Dichloro-3-Pyridinecarboxylic Acid
• 2,5-Dichloropyridine-3-Carboxylic Acid

2,5-Dichloronicotinic acid

CAS: 59782-85-3

Formula: C₆H₃Cl₂NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 191.9995

Ref: IN-DA003FXJ

2,5-Dichloronicotinic acid

CAS: 59782-85-3

2,5-Dichloronicotinic acid

Formula: C₆H₃Cl₂NO₂

Purity: ≥95%

Color and Shape: white powder

Molecular weight: 192.00g/mol

Ref: 54-OR3876

2,5-Dichloronicotinic Acid

CAS: 59782-85-3

Formula: C₆H₃Cl₂NO₂

Purity: >97.0%(GC)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 192.00

Ref: 3B-D4240

2,5-Dichloronicotinic acid

CAS: 59782-85-3

Formula: C₆H₃Cl₂NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 192

Ref: 10-F033571