CAS 59782-90-0

2,5-Dichloro-3-methylpyridine

Description:

2,5-Dichloro-3-methylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with two chlorine atoms and a methyl group. Its molecular formula is C7H6Cl2N, indicating the presence of carbon, hydrogen, chlorine, and nitrogen atoms. This compound typically appears as a colorless to pale yellow liquid or solid, depending on temperature and purity. It has a distinct odor and is soluble in organic solvents, while being less soluble in water. The presence of chlorine atoms contributes to its reactivity, making it useful in various chemical syntheses and applications, particularly in the pharmaceutical and agrochemical industries. 2,5-Dichloro-3-methylpyridine can participate in electrophilic aromatic substitution reactions and may serve as a building block for more complex molecules. Safety considerations include handling it in a well-ventilated area and using appropriate personal protective equipment, as it may pose health risks if inhaled or ingested.

Formula: C₆H₅Cl₂N

InChI: InChI=1/C6H5Cl2N/c1-4-2-5(7)6(8)9-3-4/h2-3H,1H3

SMILES: Cc1cc(c(Cl)nc1)Cl

Synonyms:

• Pyridine, 2,5-dichloro-3-methyl-
• 2,3-Dichloro-5-Methylpyridine
• 2,5-Dichloro-3-Picoline

2,5-Dichloro-3-Methylpyridine

CAS: 59782-90-0

Formula: C₆H₅Cl₂N

Purity: 97%

Color and Shape: Solid

Molecular weight: 162.0166

Ref: IN-DA003FX1

2,3-Dichloro-5-methylpyridine

CAS: 59782-90-0

2,3-Dichloro-5-methylpyridine

Purity: 98%

Color and Shape: Solid

Molecular weight: 162.02g/mol

Ref: 54-OR3473

2,3-Dichloro-5-methylpyridine

CAS: 59782-90-0

Formula: C₆H₅Cl₂N

Purity: 97%

Color and Shape: Solid

Molecular weight: 162.01

Ref: 10-F033108