CAS 5979-01-1
:4,6-Pteridinedione, 2-amino-3,5-dihydro-, hydrate (1:1)
Description:
4,6-Pteridinedione, 2-amino-3,5-dihydro-, hydrate (1:1), commonly referred to as a derivative of pteridine, is a chemical compound characterized by its bicyclic structure that includes a pteridine ring system. This compound features two carbonyl groups and an amino group, contributing to its reactivity and potential biological activity. The hydrate form indicates that it contains water molecules in its crystalline structure, which can influence its solubility and stability. Typically, pteridine derivatives are of interest in medicinal chemistry due to their roles in biological systems, including as precursors to important biomolecules like folate. The compound may exhibit properties such as being a weak acid or base, depending on the pH of the environment. Its applications can range from pharmaceuticals to biochemical research, particularly in studies related to enzyme activity and metabolic pathways. Safety data should be consulted for handling and usage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C6H5N5O2·H2O
InChI:InChI=1S/C6H5N5O2.H2O/c7-6-10-4-3(5(13)11-6)9-2(12)1-8-4;/h1H,(H,9,12)(H3,7,8,10,11,13);1H2
InChI key:InChIKey=GXYCFNCAIXIUMR-UHFFFAOYSA-N
SMILES:O=C1C2=C(NC(N)=N1)N=CC(=O)N2.O
Synonyms:- 2-Amino-1,5-Dihydropteridine-4,6-Dione Hydrate
- 2-Amino-1,5-dihydro-4,6-pteridinedione monohydrate
- 2-Amino-4,6-dihydroxypteridine monohydrate
- 2-Amino-4,6-pteridinediol monohydrate
- 2-Aminopteridine-4,6-Diol
- 4,6-Pteridinediol, 2-amino-, hydrate
- 4,6-Pteridinedione, 2-amino-1,5-dihydro-, monohydrate
- 4,6-Pteridinedione, 2-amino-3,5-dihydro-, hydrate (1:1)
- Xanthopterin monohydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Xanthopterin (hydrate)
CAS:Xanthopterin Hydrate is isolated from butterfly wings and could replace folic acid in the nutrition of many animal species.Formula:C6H7N5O3Purity:98.99% - 99.93%Color and Shape:Yellow To Orange Crystalline PowderMolecular weight:197.152-Amino-3,5-dihydropteridine-4,6-dione
CAS:Formula:C6H7N5O3Purity:98%Color and Shape:SolidMolecular weight:197.15152-Aminopteridine-4,6(3H,5H)-Dione Hydrate
CAS:<p>2-Aminopteridine-4,6(3H,5H)-Dione Hydrate</p>Purity:98%Molecular weight:197.15g/molXanthopterin monohydrate
CAS:<p>Xanthopterin monohydrate is a synthetic compound that serves as a biochemical reagent. It is derived from natural sources such as butterfly wings and certain microorganisms, although it is primarily produced through laboratory synthesis for research purposes. As a pteridine derivative, xanthopterin is involved in various metabolic processes and pathways, particularly in the enzymatic biosynthesis of folic acid.</p>Formula:C6H5N5O2•H2OPurity:Min. 95%Color and Shape:Off-White PowderMolecular weight:197.15 g/molXanthopterin Hydrate
CAS:Controlled Product<p>Applications Xanthopterin (cas# 5979-01-1) is useful as a crystal nucleation of vinylidene chloride polymers.<br>References Beck, H. N., et al.: U.S. (1974), US 3819595 A<br></p>Formula:C6H5N5O2·H2OColor and Shape:NeatMolecular weight:179.14 + 18.02





