CAS 59798-73-1

Enilospirone

Description:

Enilospirone is a chemical compound classified as a selective serotonin receptor agonist, specifically targeting the 5-HT1A receptor. It is primarily known for its potential use in the treatment of anxiety and depression due to its anxiolytic and antidepressant properties. The compound exhibits a unique structure that allows it to interact effectively with serotonin receptors, influencing neurotransmitter activity in the brain. Enilospirone is characterized by its moderate lipophilicity, which facilitates its ability to cross the blood-brain barrier, enhancing its therapeutic effects. Additionally, it has a relatively low toxicity profile, making it a candidate for further pharmacological studies. The compound's pharmacokinetics, including absorption, distribution, metabolism, and excretion, are essential for understanding its efficacy and safety in clinical applications. Overall, Enilospirone represents a significant interest in psychopharmacology, with ongoing research aimed at elucidating its full therapeutic potential and mechanisms of action.

Formula: C₁₅H₁₈ClNO₃

InChI: InChI=1S/C15H18ClNO3/c1-10-14(18)17-15(20-10)8-3-2-7-13(15)19-12-6-4-5-11(16)9-12/h4-6,9-10,13H,2-3,7-8H2,1H3,(H,17,18)

InChI key: InChIKey=PSHBCUHYCLAGPZ-UHFFFAOYSA-N

SMILES: O(C1C2(NC(=O)C(C)O2)CCCC1)C3=CC(Cl)=CC=C3

Synonyms:

• 6-(3-Chlorophenoxy)-2-methyl-1-oxa-4-azaspiro[4.5]decan-3-one
• 3726CERM
• Enilospirone
• 1-Oxa-4-azaspiro[4.5]decan-3-one, 6-(3-chlorophenoxy)-2-methyl-

Enilospirone

CAS: 59798-73-1

Enilospirone is a selective 5-HT1A receptor agonist of the azapirone class.

Formula: C₁₅H₁₈ClNO₃

Color and Shape: Solid

Molecular weight: 295.76

Ref: TM-T69034