CAS 598-35-6
:Lactaldehyde
Description:
Lactaldehyde, also known as 2-hydroxypropanal, is an organic compound with the molecular formula C3H8O2. It is classified as an aldehyde and is characterized by the presence of both an aldehyde functional group and a hydroxyl group, making it a beta-hydroxy aldehyde. Lactaldehyde is a colorless liquid with a sweet, pleasant odor and is soluble in water, reflecting its polar nature due to the hydroxyl group. It is typically produced through the fermentation of carbohydrates or can be synthesized via various chemical reactions, including the reduction of lactic acid. Lactaldehyde is used in organic synthesis and can serve as an intermediate in the production of other chemicals, including pharmaceuticals and flavoring agents. Its reactivity is influenced by the aldehyde group, which can participate in various chemical reactions, such as oxidation and condensation. Safety considerations include its potential irritant properties, and it should be handled with care in a controlled environment.
Formula:C3H6O2
InChI:InChI=1S/C3H6O2/c1-3(5)2-4/h2-3,5H,1H3
InChI key:InChIKey=BSABBBMNWQWLLU-UHFFFAOYSA-N
SMILES:C(C=O)(C)O
Synonyms:- 2-Hydroxypropanal
- 2-Hydroxypropionaldehyde
- <span class="text-smallcaps">DL</span>-Lactaldehyde
- DL-Lactaldehyde
- Lactaldehyde
- Lactaldehyde(6CI,7CI,8CI)
- Propanal, 2-hydroxy-
- Racemic-glycerol formal
- a-Hydroxypropionaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
