CAS 598-70-9
:Dibromoacetamide
Description:
Dibromoacetamide is an organic compound characterized by the presence of two bromine atoms and an acetamide functional group. Its molecular formula is C2H4Br2N2O, indicating that it contains carbon, hydrogen, bromine, nitrogen, and oxygen. This compound typically appears as a white to off-white solid and is soluble in polar solvents. Dibromoacetamide is known for its use as a reagent in organic synthesis and as a potential antimicrobial agent. It exhibits properties such as being a halogenated amide, which can influence its reactivity and biological activity. The presence of bromine atoms enhances its electrophilic character, making it useful in various chemical reactions, including substitution and addition reactions. Additionally, dibromoacetamide has been studied for its potential applications in pharmaceuticals and as a biocide. However, due to its halogenated nature, it may also pose environmental and health risks, necessitating careful handling and disposal. Overall, dibromoacetamide is a versatile compound with significant implications in both synthetic chemistry and biological research.
Formula:C2H3Br2NO
InChI:InChI=1S/C2H3Br2NO/c3-1(4)2(5)6/h1H,(H2,5,6)
InChI key:InChIKey=YUIKPESWSMJSMP-UHFFFAOYSA-N
SMILES:C(C(N)=O)(Br)Br
Synonyms:- Acetamide, 2,2-Dibromo-
- Dibromoacetamide
- NSC 98282
- 2,2-Dibromoacetamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Dibromoacetamide
CAS:Applications Dibromoacetamide is a byproduct produced from water purifciation processes.
References Chuang, Y., et al.: Env. Sci. Tech., 53, 3729 (2019);Formula:C2H3Br2NOColor and Shape:White To Off-WhiteMolecular weight:216.862,2-Dibromoacetamide
CAS:2,2-Dibromoacetamide is a class of disinfection by-product (DBP) in drinking water.Formula:C2H3Br2NOColor and Shape:SolidMolecular weight:216.862,2-Dibromoacetamide
CAS:2,2-Dibromoacetamide is a chemical compound that is used in pharmacology research. It can be used to study the effects of receptors on ligands and their binding sites. This product is also used as an inhibitor in cell biology, such as cancer research. 2,2-Dibromoacetamide has been shown to interact with ion channels and peptides, which may lead to further research into its biological activity.Formula:C2H3Br2NOPurity:Min. 95%Molecular weight:216.86 g/mol


