CAS 598-82-3: Lactic acid

Description:Lactic acid, with the CAS number 598-82-3, is an organic acid characterized by its molecular formula C3H6O3. It is a colorless, syrupy liquid that is soluble in water, ethanol, and ether, making it versatile in various applications. Lactic acid exists in two optical isomers: L-lactic acid and D-lactic acid, with L-lactic acid being the more biologically relevant form, commonly produced in the human body during anaerobic respiration. It has a slightly sour taste and is known for its role in food preservation and flavor enhancement, often used in dairy products, pickles, and fermented foods. In addition to its culinary uses, lactic acid is significant in the pharmaceutical and cosmetic industries, serving as a pH regulator and moisturizer. It also plays a role in biochemistry as an intermediate in metabolic processes. Lactic acid is generally recognized as safe (GRAS) when used in food applications, but it can cause irritation in concentrated forms. Its biodegradable nature makes it an attractive option in sustainable practices and materials.

Formula:C₃H₆O₃

InChI:InChI=1S/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)

InChI key:InChIKey=JVTAAEKCZFNVCJ-UHFFFAOYSA-N

SMILES:O=C(O)C(O)C