CAS 5980-24-5
:2,3-Dichlorobenzamide
Description:
2,3-Dichlorobenzamide is an organic compound characterized by its benzene ring substituted with two chlorine atoms at the 2 and 3 positions and an amide functional group. It is typically a white to off-white crystalline solid, exhibiting moderate solubility in polar solvents such as water and ethanol. The presence of chlorine atoms contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. As an amide, it can participate in hydrogen bonding, influencing its physical properties and interactions with biological systems. The compound is often studied for its potential biological activities, including herbicidal properties, and may serve as an intermediate in the synthesis of other chemical compounds. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Proper storage and disposal methods are essential to mitigate any risks associated with its use.
Formula:C7H5Cl2NO
InChI:InChI=1/C7H5Cl2NO/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H2,10,11)
SMILES:c1cc(c(cc1Cl)C(=N)O)Cl
Synonyms:- Benzamide, 2,5-dichloro-
- 2,5-Dichlorobenzamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,3-Dichlorobenzamide
CAS:<p>2,3-Dichlorobenzamide is a herbicide with a stable structure. It has been shown to be effective against the weed species Agropyron repens and other grasses that grow in wetland conditions. 2,3-Dichlorobenzamide inhibits the growth of these plants by causing chlorosis, which is characterized by yellowing of leaves. 2,3-Dichlorobenzamide is toxic to aquatic organisms and can cause pollution in water systems. The molecular electrostatic potential of 2,3-Dichlorobenzamide has been studied using computer models and the parameters have been used to predict its toxicity to various tissues such as nerves or liver cells.</p>Formula:C7H5Cl2NOPurity:Min. 95%Color and Shape:PowderMolecular weight:190.03 g/mol
