CAS 5981-17-9

dodecahydrotripyrrolo[1,2-a:1',2'-c:1'',2''-e][1,3,5]triazine

Description:

Dodecahydrotripyrrolo[1,2-a:1',2'-c:1'',2''-e][1,3,5]triazine, with the CAS number 5981-17-9, is a heterocyclic compound characterized by its complex polycyclic structure, which includes multiple nitrogen atoms within its rings. This compound is part of a class of triazines, known for their diverse applications in fields such as pharmaceuticals, agrochemicals, and materials science. Its unique arrangement of pyrrole and triazine units contributes to its potential reactivity and stability. The presence of multiple nitrogen atoms can enhance its ability to form hydrogen bonds, influencing its solubility and interaction with other chemical species. Additionally, the saturated nature of the compound suggests it may exhibit different physical properties compared to unsaturated analogs, such as increased stability under certain conditions. While specific data on its physical and chemical properties may vary, compounds of this type are often studied for their electronic properties and potential as building blocks in organic synthesis.

Formula: C₁₂H₂₁N₃

InChI: InChI=1/C12H21N3/c1-4-10-13(7-1)11-5-2-9-15(11)12-6-3-8-14(10)12/h10-12H,1-9H2

SMILES: C1CC2N(C1)C1CCCN1C1CCCN21

Synonyms:

• Dodecahydrotripyrrolo[1,2-a:1',2'-c:1",2"-e][1,3,5]triazine
• Dodecahydrotripyrrolo(1,2-a:1',2'-c:1"",2""-e)(1,3,5)triazine

1-Pyrroline (Mixture of Monomer and Trimer)

Controlled Product

CAS: 5724-81-2, 5981-17-9

Applications It is used in the Biological study and evaluation of aliphatic and aromatic amines and amides as flavoring materials.
References Anadon, A., et al.: EFSA. Journal., 9, 42 (2011)

Formula: C₁₂H₂₁N₃·C₄H₇N

Color and Shape: Neat

Molecular weight: 276.43

Ref: TR-P572480

Tripyrroline

CAS: 5981-17-9

Tripyrroline is an analog of a Chinese medicinal compound that has been shown to have potent anticancer properties. It acts as a protein kinase inhibitor, which means it can inhibit the activity of enzymes involved in cancer cell growth and proliferation. Tripyrroline induces apoptosis, or programmed cell death, in cancer cells, leading to their destruction. This compound has been found in human urine and has shown promising results in inhibiting tumor growth. Tripyrroline may be a valuable tool for developing new cancer therapies.

Formula: C₁₂H₂₁N₃

Purity: Min. 95%

Molecular weight: 207.32 g/mol

Ref: 3D-FAA98117