CAS 59812-12-3

N-(Ethoxycarbonyl)thiopropionamide

Description:

N-(Ethoxycarbonyl)thiopropionamide is an organic compound characterized by its functional groups, which include an ethoxycarbonyl group and a thiopropionamide moiety. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It is soluble in organic solvents, reflecting its non-polar characteristics, while its polar functional groups may impart some degree of solubility in polar solvents. The presence of the thiol group suggests potential reactivity, particularly in nucleophilic substitution reactions or in the formation of disulfides. Additionally, the ethoxycarbonyl group can participate in various chemical reactions, such as esterification or amidation. This compound may be of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its potential biological activity. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₆H₁₁NO₂S

InChI: InChI=1/C6H11NO2S/c1-3-5(10)7-6(8)9-4-2/h3-4H2,1-2H3,(H,7,8,10)

SMILES: CCC(=NC(=O)OCC)S

Synonyms:

• Ethyl Propanethioylcarbamate