CAS 59813-89-7
:2-(ethylsulfanyl)-1,3-benzothiazol-6-amine
Description:
2-(Ethylsulfanyl)-1,3-benzothiazol-6-amine, with the CAS number 59813-89-7, is an organic compound characterized by its unique structure that includes a benzothiazole ring system. This compound features an ethylsulfanyl group, which contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of an amine functional group enhances its ability to participate in hydrogen bonding, influencing its solubility and interaction with biological systems. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry. The molecular structure suggests potential for diverse reactivity, including nucleophilic substitution and coupling reactions. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and solvent polarity. Overall, 2-(ethylsulfanyl)-1,3-benzothiazol-6-amine represents a class of compounds that may serve as valuable intermediates or active agents in chemical synthesis and drug development.
Formula:C9H10N2S2
InChI:InChI=1/C9H10N2S2/c1-2-12-9-11-7-4-3-6(10)5-8(7)13-9/h3-5H,2,10H2,1H3
SMILES:CCSc1nc2ccc(cc2s1)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
BIR2
CAS:BIR2 triggers hESC self-organization into 3D balloon structures during differentiation.Formula:C9H10N2S2Color and Shape:SolidMolecular weight:210.32
