
CAS 5982-87-6
:Benzenepropanamine, N-ethyl-N-(3-phenylpropyl)-, hydrochloride (1:1)
Description:
Benzenepropanamine, N-ethyl-N-(3-phenylpropyl)-, hydrochloride (1:1), with the CAS number 5982-87-6, is a chemical compound that belongs to the class of amines. It features a benzene ring attached to a propanamine structure, specifically with an ethyl group and a phenylpropyl moiety. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its handling in various applications. The presence of the amine functional group suggests potential basicity and reactivity, making it relevant in organic synthesis and pharmaceutical chemistry. Its structure indicates that it may exhibit properties such as being a potential neurotransmitter or a precursor in the synthesis of other biologically active compounds. Additionally, due to its aromatic nature, it may possess certain stability and hydrophobic characteristics. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper laboratory practices.
Formula:C20H27N·ClH
InChI:InChI=1S/C20H27N.ClH/c1-2-21(17-9-15-19-11-5-3-6-12-19)18-10-16-20-13-7-4-8-14-20;/h3-8,11-14H,2,9-10,15-18H2,1H3;1H
InChI key:InChIKey=ZKRKHXXSBDSIKQ-UHFFFAOYSA-N
SMILES:C(CCN(CCCC1=CC=CC=C1)CC)C2=CC=CC=C2.Cl
Synonyms:- Benzenepropanamine, N-ethyl-N-(3-phenylpropyl)-, hydrochloride (1:1)
- Dipropylamine, N-ethyl-3,3′-diphenyl-, hydrochloride
- N-Ethyl-3,3′-diphenyldipropylamine hydrochloride
- Benzenepropanamine, N-ethyl-N-(3-phenylpropyl)-, hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Alverine hydrochloride
CAS:<p>Alverine hydrochloride is a parasympatholytic.</p>Formula:C20H28ClNColor and Shape:SolidMolecular weight:317.9
