CAS 59820-83-6
:6-methyl-7-nitro-2,3-dihydro-1,4-benzodioxine
Description:
6-Methyl-7-nitro-2,3-dihydro-1,4-benzodioxine is an organic compound characterized by its unique bicyclic structure, which includes a benzodioxine moiety. This compound features a methyl group and a nitro group, contributing to its chemical reactivity and potential applications in various fields. The presence of the nitro group typically enhances the compound's electrophilic properties, making it useful in synthetic organic chemistry. The bicyclic structure also suggests potential for interesting interactions with biological systems, which may be explored in pharmacological studies. Additionally, the compound's molecular configuration can influence its solubility, stability, and reactivity, which are critical factors in its practical applications. As with many nitro-containing compounds, safety considerations regarding its handling and storage are essential due to potential toxicity and environmental impact. Overall, 6-methyl-7-nitro-2,3-dihydro-1,4-benzodioxine represents a compound of interest for further research in both synthetic and applied chemistry contexts.
Formula:C9H9NO4
InChI:InChI=1/C9H9NO4/c1-6-4-8-9(14-3-2-13-8)5-7(6)10(11)12/h4-5H,2-3H2,1H3
SMILES:Cc1cc2c(cc1N(=O)=O)OCCO2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.