CAS 59826-53-8: 2-chloro-N-(5-methyl-1,2-oxazol-3-yl)acetamide
Description:2-Chloro-N-(5-methyl-1,2-oxazol-3-yl)acetamide is a chemical compound characterized by its unique structure, which includes a chloro group and an oxazole ring. The presence of the 2-chloro substituent indicates that it has potential reactivity, particularly in nucleophilic substitution reactions. The oxazole ring contributes to the compound's heterocyclic nature, which can influence its biological activity and solubility. This compound is typically used in research and may exhibit properties such as antimicrobial or antifungal activity, although specific biological effects would depend on the context of its use. Its molecular structure suggests that it may participate in various chemical reactions, making it of interest in synthetic organic chemistry. Additionally, the presence of the acetamide functional group indicates potential for hydrogen bonding, which can affect its physical properties, such as melting point and solubility in polar solvents. Overall, 2-chloro-N-(5-methyl-1,2-oxazol-3-yl)acetamide is a compound of interest in both synthetic and medicinal chemistry.
Formula:C6H7ClN2O2
InChI:InChI=1/C6H7ClN2O2/c1-4-2-5(9-11-4)8-6(10)3-7/h2H,3H2,1H3,(H,8,9,10)
- Synonyms:
- acetamide, 2-chloro-N-(5-methyl-3-isoxazolyl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-Chloro-N-(5-methylisoxazol-3-yl)acetamide REF: IN-DA00EA6MCAS: 59826-53-8 | 95% | 107.00 €~531.00 € | Mon 05 May 25 |
![]() | 2-chloro-N-(5-methyl-3-isoxazolyl)acetamide REF: 10-F315402CAS: 59826-53-8 | 95.0% | To inquire | Tue 13 May 25 |
![]() | 2-Chloro-N-(5-methylisoxazol-3-yl)acetamide REF: 3D-FC114034CAS: 59826-53-8 | Min. 95% | - - - | Discontinued product |

2-Chloro-N-(5-methylisoxazol-3-yl)acetamide
Ref: IN-DA00EA6M
1g | 163.00 € | ||
5g | 531.00 € | ||
250mg | 107.00 € |

2-chloro-N-(5-methyl-3-isoxazolyl)acetamide
Ref: 10-F315402
250mg | 83.00 € |

2-Chloro-N-(5-methylisoxazol-3-yl)acetamide
Ref: 3D-FC114034
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |