CAS 59832-12-1

2-[(1E)-2-nitroprop-1-en-1-yl]naphthalene

Description:

2-[(1E)-2-nitroprop-1-en-1-yl]naphthalene, with the CAS number 59832-12-1, is an organic compound characterized by its naphthalene backbone substituted with a nitroalkene group. This compound features a naphthalene ring, which is a polycyclic aromatic hydrocarbon known for its stability and hydrophobic properties. The presence of the nitro group introduces polar characteristics, potentially enhancing its reactivity and solubility in polar solvents. The compound is likely to exhibit interesting electronic properties due to the conjugation between the naphthalene and the nitroalkene moiety, which may influence its behavior in chemical reactions, such as electrophilic substitutions or nucleophilic additions. Additionally, the compound may possess biological activity, making it of interest in medicinal chemistry or materials science. Its stability, reactivity, and potential applications can be influenced by factors such as temperature, solvent, and the presence of other functional groups. As with many nitro compounds, it is essential to handle this substance with care due to potential toxicity and environmental impact.

Formula: C₁₃H₁₁NO₂

InChI: InChI=1/C13H11NO2/c1-10(14(15)16)8-11-6-7-12-4-2-3-5-13(12)9-11/h2-9H,1H3/b10-8+

1-NITRO-1-METHYL-2-NAPHTYLETHENE

CAS: 59832-12-1

Formula: C₁₃H₁₁NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 213.2319

Ref: IN-DA00EFJ3