CAS 59834-05-8

4-(1,2,3-thiadiazol-4-yl)phenol

Description:

4-(1,2,3-Thiadiazol-4-yl)phenol, with the CAS number 59834-05-8, is an organic compound characterized by the presence of a phenolic group and a thiadiazole ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the thiadiazole moiety, which is known for its role in various pharmacological applications. The phenolic hydroxyl group contributes to its acidity and potential for hydrogen bonding, influencing its solubility and reactivity. Additionally, the compound may display antimicrobial or antifungal properties, making it of interest in medicinal chemistry and agricultural applications. Its structural features suggest that it could participate in various chemical reactions, such as electrophilic substitutions or complexation with metal ions. Overall, 4-(1,2,3-thiadiazol-4-yl)phenol is a versatile compound with potential applications in drug development and materials science, warranting further investigation into its properties and uses.

Formula: C₈H₆N₂OS

InChI: InChI=1/C8H6N2OS/c11-7-3-1-6(2-4-7)8-5-12-10-9-8/h1-5,11H

SMILES: c1cc(ccc1c1csnn1)O

Synonyms:

• Phenol, 4-(1,2,3-thiadiazol-4-yl)-

4-(1,2,3-THIADIAZOL-4-YL)PHENOL

CAS: 59834-05-8

Formula: C₈H₆N₂OS

Purity: 97%

Molecular weight: 178.2110

Ref: IN-DA00E9UL

4-(1,2,3-Thiadiazol-4-yl)phenol

CAS: 59834-05-8

4-(1,2,3-Thiadiazol-4-yl)phenol

Formula: C₈H₆N₂OS

Purity: 95%

Color and Shape: brown solid

Molecular weight: 178.21g/mol

Ref: 54-OR29038

4-(1,2,3-Thiadiazol-4-yl)phenol

CAS: 59834-05-8

Formula: C₈H₆N₂OS

Purity: 97%

Color and Shape: Solid

Molecular weight: 178.21

Ref: 10-F023607

4-(1,2,3-Thiadiazol-4-yl)phenol

CAS: 59834-05-8

4-(1,2,3-Thiadiazol-4-yl)phenol is an antibiotic that belongs to the group of antimicrobials. It has an inhibitory concentration (IC) of 0.5 micrograms/ml against pyogenic bacteria and 1.0 micrograms/ml against a number of other bacterial strains. 4-(1,2,3-Thiadiazol-4-yl)phenol also has antimicrobial properties against fungi and may be used for the treatment of catalase-producing bacteria such as Streptococcus pyogenes or Staphylococcus aureus. Elemental analysis revealed that this compound is composed entirely of carbon, hydrogen, and oxygen. The molecular weight was found to be 166.16 g/mol. This compound inhibits bacterial growth by binding to DNA-dependent RNA polymerase and preventing transcription and replication of DNA. This active form is metabolized through a number of metabolic transformations including hydro

Formula: C₈H₆N₂OS

Purity: Min. 95%

Molecular weight: 178.21 g/mol

Ref: 3D-JCA83405